About 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine
8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine (PubChem CID 150892057) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine |
| PubChem CID | 150892057 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine |
| SMILES | Fc1ccc2c(c1)NCCN=C2 |
| InChI | InChI=1S/C9H9FN2/c10-8-2-1-7-6-11-3-4-12-9(7)5-8/h1-2,5-6,12H,3-4H2 |
| InChIKey | KYFHBAUBKXBFKS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine?
The IUPAC name of 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine (CID 150892057) is 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine.
What is the SMILES notation for 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine?
The canonical SMILES for 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine is Fc1ccc2c(c1)NCCN=C2.
What is the InChIKey of 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine?
The InChIKey is KYFHBAUBKXBFKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c10-8-2-1-7-6-11-3-4-12-9(7)5-8/h1-2,5-6,12H,3-4H2.
What are the key properties of 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine?
8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine has a molecular weight of 164.18 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2,3-dihydro-1H-1,4-benzodiazepine is sourced from PubChem (CID 150892057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).