C33H31Cl2FN6O2 — CID 150892270
2-chloro-4-[2-[[9-chloro-7-(2-fluoro-6-methoxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-3-methyl-3-(methylamino)piperidine-1-carbaldehyde (PubChem CID 150892270) has the molecular formula C33H31Cl2FN6O2 and a molecular weight of 633.56 g/mol. Its IUPAC name is 2-chloro-4-[2-[[9-chloro-7-(2-fluoro-6-methoxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-3-methyl-3-(methylamino)piperidine-1-carbaldehyde.
| Compound Name | 2-chloro-4-[2-[[9-chloro-7-(2-fluoro-6-methoxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-3-methyl-3-(methylamino)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 150892270 |
| Molecular Formula | C33H31Cl2FN6O2 |
| Molecular Weight | 633.56 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2-chloro-4-[2-[[9-chloro-7-(2-fluoro-6-methoxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-3-methyl-3-(methylamino)piperidine-1-carbaldehyde |
| SMILES | CNC1(C)C(c2ccccc2Nc2ncc3c(n2)-c2ccc(Cl)cc2C(c2c(F)cccc2OC)=NC3)CCN(C=O)C1Cl |
| InChI | InChI=1S/C33H31Cl2FN6O2/c1-33(37-2)24(13-14-42(18-43)31(33)35)22-7-4-5-9-26(22)40-32-39-17-19-16-38-30(28-25(36)8-6-10-27(28)44-3)23-15-20(34)11-12-21(23)29(19)41-32/h4-12,15,17-18,24,31,37H,13-14,16H2,1-3H3,(H,39,40,41) |
| InChIKey | KYGLQCBGKMCGBA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|