About (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate
(1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate (PubChem CID 150894528) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate |
| PubChem CID | 150894528 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate |
| SMILES | CC1CC=C(C(=O)OC2(C)CCCCC2)CC1 |
| InChI | InChI=1S/C15H24O2/c1-12-6-8-13(9-7-12)14(16)17-15(2)10-4-3-5-11-15/h8,12H,3-7,9-11H2,1-2H3 |
| InChIKey | KYSARYZHOMRQJP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate?
The IUPAC name of (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate (CID 150894528) is (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate.
What is the SMILES notation for (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate?
The canonical SMILES for (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate is CC1CC=C(C(=O)OC2(C)CCCCC2)CC1.
What is the InChIKey of (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate?
The InChIKey is KYSARYZHOMRQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-12-6-8-13(9-7-12)14(16)17-15(2)10-4-3-5-11-15/h8,12H,3-7,9-11H2,1-2H3.
What are the key properties of (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate?
(1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate has a molecular weight of 236.35 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) 4-methylcyclohexene-1-carboxylate is sourced from PubChem (CID 150894528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).