C32H19Br3 — CID 150895090
2,3-diphenyl-1-(2,4,6-tribromophenyl)anthracene (PubChem CID 150895090) has the molecular formula C32H19Br3 and a molecular weight of 643.22 g/mol. Its IUPAC name is 2,3-diphenyl-1-(2,4,6-tribromophenyl)anthracene.
| Compound Name | 2,3-diphenyl-1-(2,4,6-tribromophenyl)anthracene |
|---|---|
| PubChem CID | 150895090 |
| Molecular Formula | C32H19Br3 |
| Molecular Weight | 643.22 g/mol |
| Exact Mass | 639.90 |
| IUPAC Name | 2,3-diphenyl-1-(2,4,6-tribromophenyl)anthracene |
| SMILES | Brc1cc(Br)c(-c2c(-c3ccccc3)c(-c3ccccc3)cc3cc4ccccc4cc23)c(Br)c1 |
| InChI | InChI=1S/C32H19Br3/c33-25-18-28(34)32(29(35)19-25)31-27-16-23-14-8-7-13-22(23)15-24(27)17-26(20-9-3-1-4-10-20)30(31)21-11-5-2-6-12-21/h1-19H |
| InChIKey | KYVAMESYCZJCAJ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.22 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|