About ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate
ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 150896201) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 150896201 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1(N2CCCCC2)C=CC(N)=CC1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-18-13(17)14(8-6-12(15)7-9-14)16-10-4-3-5-11-16/h6-8H,2-5,9-11,15H2,1H3 |
| InChIKey | KZASEKXIITUHLD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate (CID 150896201) is ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate is CCOC(=O)C1(N2CCCCC2)C=CC(N)=CC1.
What is the InChIKey of ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is KZASEKXIITUHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-2-18-13(17)14(8-6-12(15)7-9-14)16-10-4-3-5-11-16/h6-8H,2-5,9-11,15H2,1H3.
What are the key properties of ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 250.34 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-amino-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 150896201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).