About 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine
2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine (PubChem CID 150897251) has the molecular formula C17H33N3OSSi
and a molecular weight of 355.62 g/mol. Its IUPAC name is 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine |
| PubChem CID | 150897251 |
| Molecular Formula | C17H33N3OSSi |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine |
| SMILES | [H]N=S(=O)(N[Si](C)(C)C(C)(C)C)c1ccc(C(C)(C)N(C)C)cc1 |
| InChI | InChI=1S/C17H33N3OSSi/c1-16(2,3)23(8,9)19-22(18,21)15-12-10-14(11-13-15)17(4,5)20(6)7/h10-13H,1-9H3,(H2,18,19,21) |
| InChIKey | KZGBUWOEYSVOMH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine?
The IUPAC name of 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine (CID 150897251) is 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine?
The canonical SMILES for 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine is [H]N=S(=O)(N[Si](C)(C)C(C)(C)C)c1ccc(C(C)(C)N(C)C)cc1.
What is the InChIKey of 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine?
The InChIKey is KZGBUWOEYSVOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3OSSi/c1-16(2,3)23(8,9)19-22(18,21)15-12-10-14(11-13-15)17(4,5)20(6)7/h10-13H,1-9H3,(H2,18,19,21).
What are the key properties of 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine?
2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine has a molecular weight of 355.62 g/mol, XLogP of 4.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[[tert-butyl(dimethyl)silyl]amino]sulfonimidoyl]phenyl]-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 150897251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).