C12H9F8NO2 — CID 150898978
2-amino-4-(2,2,3,3,4,4,5,5-octafluorocyclohexyl)oxyphenol (PubChem CID 150898978) has the molecular formula C12H9F8NO2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2-amino-4-(2,2,3,3,4,4,5,5-octafluorocyclohexyl)oxyphenol.
| Compound Name | 2-amino-4-(2,2,3,3,4,4,5,5-octafluorocyclohexyl)oxyphenol |
|---|---|
| PubChem CID | 150898978 |
| Molecular Formula | C12H9F8NO2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-amino-4-(2,2,3,3,4,4,5,5-octafluorocyclohexyl)oxyphenol |
| SMILES | Nc1cc(OC2CC(F)(F)C(F)(F)C(F)(F)C2(F)F)ccc1O |
| InChI | InChI=1S/C12H9F8NO2/c13-9(14)4-8(10(15,16)12(19,20)11(9,17)18)23-5-1-2-7(22)6(21)3-5/h1-3,8,22H,4,21H2 |
| InChIKey | KZPMGUDTMNGOFV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|