About 1H-benzo[b]carbazole
1H-benzo[b]carbazole (PubChem CID 15089918) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is 1H-benzo[b]carbazole.
Molecular Properties
| Compound Name | 1H-benzo[b]carbazole |
| PubChem CID | 15089918 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1H-benzo[b]carbazole |
| SMILES | C1=CCC2=c3cc4ccccc4cc3=NC2=C1 |
| InChI | InChI=1S/C16H11N/c1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/h1-6,8-10H,7H2 |
| InChIKey | PWVAIVPOLYRMET-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzo[b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[b]carbazole?
The IUPAC name of 1H-benzo[b]carbazole (CID 15089918) is 1H-benzo[b]carbazole.
What is the SMILES notation for 1H-benzo[b]carbazole?
The canonical SMILES for 1H-benzo[b]carbazole is C1=CCC2=c3cc4ccccc4cc3=NC2=C1.
What is the InChIKey of 1H-benzo[b]carbazole?
The InChIKey is PWVAIVPOLYRMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/h1-6,8-10H,7H2.
What are the key properties of 1H-benzo[b]carbazole?
1H-benzo[b]carbazole has a molecular weight of 217.27 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[b]carbazole is sourced from PubChem (CID 15089918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).