C13H12F3N — CID 150901028
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-carbazole (PubChem CID 150901028) has the molecular formula C13H12F3N and a molecular weight of 239.24 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-carbazole.
| Compound Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 150901028 |
| Molecular Formula | C13H12F3N |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-carbazole |
| SMILES | FC(F)(F)C1=CCC2=NC3=CCCCC3=C2C1 |
| InChI | InChI=1S/C13H12F3N/c14-13(15,16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)17-12/h4-5H,1-3,6-7H2 |
| InChIKey | KZZUTUAYLDEHCT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|