About (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol
(E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol (PubChem CID 15090182) has the molecular formula C12H26OSi
and a molecular weight of 214.42 g/mol. Its IUPAC name is (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol.
Molecular Properties
| Compound Name | (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol |
| PubChem CID | 15090182 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol |
| SMILES | CC(C)(C/C=C/C[Si](C)(C)C)CCO |
| InChI | InChI=1S/C12H26OSi/c1-12(2,9-10-13)8-6-7-11-14(3,4)5/h6-7,13H,8-11H2,1-5H3/b7-6+ |
| InChIKey | REEPRFAOCKMAPC-VOTSOKGWSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol?
The IUPAC name of (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol (CID 15090182) is (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol.
What is the SMILES notation for (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol?
The canonical SMILES for (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol is CC(C)(C/C=C/C[Si](C)(C)C)CCO.
What is the InChIKey of (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol?
The InChIKey is REEPRFAOCKMAPC-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H26OSi/c1-12(2,9-10-13)8-6-7-11-14(3,4)5/h6-7,13H,8-11H2,1-5H3/b7-6+.
What are the key properties of (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol?
(E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol has a molecular weight of 214.42 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3-dimethyl-7-trimethylsilylhept-5-en-1-ol is sourced from PubChem (CID 15090182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).