About 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane
3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane (PubChem CID 150903948) has the molecular formula C24H46O5
and a molecular weight of 414.63 g/mol. Its IUPAC name is 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane.
Molecular Properties
| Compound Name | 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane |
| PubChem CID | 150903948 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane |
| SMILES | CCC=COCCCC1(OCCCC)CCCOC1(OCCCC)OCCCC |
| InChI | InChI=1S/C24H46O5/c1-5-9-17-25-18-13-15-23(26-19-10-6-2)16-14-22-29-24(23,27-20-11-7-3)28-21-12-8-4/h9,17H,5-8,10-16,18-22H2,1-4H3 |
| InChIKey | LAOVPZGABQBJSR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane?
The IUPAC name of 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane (CID 150903948) is 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane.
What is the SMILES notation for 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane?
The canonical SMILES for 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane is CCC=COCCCC1(OCCCC)CCCOC1(OCCCC)OCCCC.
What is the InChIKey of 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane?
The InChIKey is LAOVPZGABQBJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O5/c1-5-9-17-25-18-13-15-23(26-19-10-6-2)16-14-22-29-24(23,27-20-11-7-3)28-21-12-8-4/h9,17H,5-8,10-16,18-22H2,1-4H3.
What are the key properties of 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane?
3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane has a molecular weight of 414.63 g/mol, XLogP of 6.36, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-but-1-enoxypropyl)-2,2,3-tributoxyoxane is sourced from PubChem (CID 150903948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).