C11H12O2 — CID 15090452
2-hydroxy-3,3-dimethyl-2H-inden-1-one (PubChem CID 15090452) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-hydroxy-3,3-dimethyl-2H-inden-1-one.
| Compound Name | 2-hydroxy-3,3-dimethyl-2H-inden-1-one |
|---|---|
| PubChem CID | 15090452 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-hydroxy-3,3-dimethyl-2H-inden-1-one |
| SMILES | CC1(C)c2ccccc2C(=O)C1O |
| InChI | InChI=1S/C11H12O2/c1-11(2)8-6-4-3-5-7(8)9(12)10(11)13/h3-6,10,13H,1-2H3 |
| InChIKey | ZYLHGPHDTFANBL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |