C10H10Br2N2O3 — CID 150907289
9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 150907289) has the molecular formula C10H10Br2N2O3 and a molecular weight of 366.01 g/mol. Its IUPAC name is 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylic acid.
| Compound Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 150907289 |
| Molecular Formula | C10H10Br2N2O3 |
| Molecular Weight | 366.01 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-2-carboxylic acid |
| SMILES | CC1CCC(Br)(Br)c2nc(C(=O)O)cc(=O)n21 |
| InChI | InChI=1S/C10H10Br2N2O3/c1-5-2-3-10(11,12)9-13-6(8(16)17)4-7(15)14(5)9/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | LBGAWFWSIGIGOC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|