About 2-azido-2,2-diphenylethanol
2-azido-2,2-diphenylethanol (PubChem CID 150907693) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-azido-2,2-diphenylethanol.
Molecular Properties
| Compound Name | 2-azido-2,2-diphenylethanol |
| PubChem CID | 150907693 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-azido-2,2-diphenylethanol |
| SMILES | [N-]=[N+]=NC(CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O/c15-17-16-14(11-18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,18H,11H2 |
| InChIKey | LBIDCOOJEHTFOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-2,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-2,2-diphenylethanol?
The IUPAC name of 2-azido-2,2-diphenylethanol (CID 150907693) is 2-azido-2,2-diphenylethanol.
What is the SMILES notation for 2-azido-2,2-diphenylethanol?
The canonical SMILES for 2-azido-2,2-diphenylethanol is [N-]=[N+]=NC(CO)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-azido-2,2-diphenylethanol?
The InChIKey is LBIDCOOJEHTFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O/c15-17-16-14(11-18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,18H,11H2.
What are the key properties of 2-azido-2,2-diphenylethanol?
2-azido-2,2-diphenylethanol has a molecular weight of 239.28 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-2,2-diphenylethanol is sourced from PubChem (CID 150907693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).