About 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde
5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde (PubChem CID 150908364) has the molecular formula C16H17NO5
and a molecular weight of 303.31 g/mol. Its IUPAC name is 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde |
| PubChem CID | 150908364 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde |
| SMILES | COc1cc(OC)c(-c2cc(C=O)c(OC)cc2OC)cn1 |
| InChI | InChI=1S/C16H17NO5/c1-19-13-6-14(20-2)11(5-10(13)9-18)12-8-17-16(22-4)7-15(12)21-3/h5-9H,1-4H3 |
| InChIKey | LBLSOPNFMWJRLY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde?
The IUPAC name of 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde (CID 150908364) is 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde.
What is the SMILES notation for 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde?
The canonical SMILES for 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde is COc1cc(OC)c(-c2cc(C=O)c(OC)cc2OC)cn1.
What is the InChIKey of 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde?
The InChIKey is LBLSOPNFMWJRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5/c1-19-13-6-14(20-2)11(5-10(13)9-18)12-8-17-16(22-4)7-15(12)21-3/h5-9H,1-4H3.
What are the key properties of 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde?
5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde has a molecular weight of 303.31 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,6-dimethoxy-3-pyridinyl)-2,4-dimethoxybenzaldehyde is sourced from PubChem (CID 150908364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).