About 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one
5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one (PubChem CID 15091000) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one.
Analyze 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one?
The IUPAC name of 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one (CID 15091000) is 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one.
What is the SMILES notation for 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one?
The canonical SMILES for 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one is O=C1CCCC2=C1C1C=COC1O2.
What is the InChIKey of 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one?
The InChIKey is LSBKLWPVGBGDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-7-2-1-3-8-9(7)6-4-5-12-10(6)13-8/h4-6,10H,1-3H2.
What are the key properties of 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one?
5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one has a molecular weight of 178.19 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8b-tetrahydro-3aH-furo[2,3-b][1]benzofuran-8-one is sourced from PubChem (CID 15091000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).