About 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide
2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide (PubChem CID 15091373) has the molecular formula C5ClF3N4OS
and a molecular weight of 256.60 g/mol. Its IUPAC name is 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide.
Molecular Properties
| Compound Name | 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide |
| PubChem CID | 15091373 |
| Molecular Formula | C5ClF3N4OS |
| Molecular Weight | 256.60 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1sc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C5ClF3N4OS/c6-4-11-2(5(7,8)9)1(15-4)3(14)12-13-10 |
| InChIKey | TZPJVNKZSBNOAZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide?
The IUPAC name of 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide (CID 15091373) is 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide.
What is the SMILES notation for 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide?
The canonical SMILES for 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide is [N-]=[N+]=NC(=O)c1sc(Cl)nc1C(F)(F)F.
What is the InChIKey of 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide?
The InChIKey is TZPJVNKZSBNOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5ClF3N4OS/c6-4-11-2(5(7,8)9)1(15-4)3(14)12-13-10.
What are the key properties of 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide?
2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide has a molecular weight of 256.60 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl azide is sourced from PubChem (CID 15091373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).