C17H26O3 — CID 15091458
2-decyl-5-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 15091458) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-decyl-5-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-decyl-5-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15091458 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-decyl-5-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCC1=CC(=O)C(OC)=CC1=O |
| InChI | InChI=1S/C17H26O3/c1-3-4-5-6-7-8-9-10-11-14-12-16(19)17(20-2)13-15(14)18/h12-13H,3-11H2,1-2H3 |
| InChIKey | RDGYMNWNTDUQTK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|