C19H30O2 — CID 15091459
2-decyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15091459) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-decyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-decyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15091459 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-decyl-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C19H30O2/c1-5-6-7-8-9-10-11-12-13-17-16(4)18(20)14(2)15(3)19(17)21/h5-13H2,1-4H3 |
| InChIKey | CIMKKDMWOKSBPD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|