C16H11F5O2S — CID 15091705
S-(2,3,4,5,6-pentafluorophenyl) (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate (PubChem CID 15091705) has the molecular formula C16H11F5O2S and a molecular weight of 362.32 g/mol. Its IUPAC name is S-(2,3,4,5,6-pentafluorophenyl) (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate.
| Compound Name | S-(2,3,4,5,6-pentafluorophenyl) (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
|---|---|
| PubChem CID | 15091705 |
| Molecular Formula | C16H11F5O2S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | S-(2,3,4,5,6-pentafluorophenyl) (2R,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
| SMILES | C[C@@H](C(=O)Sc1c(F)c(F)c(F)c(F)c1F)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H11F5O2S/c1-7(14(22)8-5-3-2-4-6-8)16(23)24-15-12(20)10(18)9(17)11(19)13(15)21/h2-7,14,22H,1H3/t7-,14-/m1/s1 |
| InChIKey | BQFLBRUEDVMOGE-NXSYQRQQSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|