C18H26O2S — CID 15091798
(1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylethoxy]-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 15091798) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylethoxy]-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylethoxy]-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 15091798 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylethoxy]-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | C[C@H](O[C@@H]1C[C@H]2[C@H]3CC[C@@](C)([C@H]2O1)C3(C)C)c1cccs1 |
| InChI | InChI=1S/C18H26O2S/c1-11(14-6-5-9-21-14)19-15-10-12-13-7-8-18(4,16(12)20-15)17(13,2)3/h5-6,9,11-13,15-16H,7-8,10H2,1-4H3/t11-,12-,13+,15-,16-,18-/m0/s1 |
| InChIKey | LSYQDDGNMJYBPX-VRXMZMPVSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |