C19H28O2S — CID 15091802
(1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylpropoxy]-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 15091802) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylpropoxy]-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylpropoxy]-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 15091802 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylpropoxy]-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | CC[C@H](O[C@@H]1C[C@H]2[C@H]3CC[C@@](C)([C@H]2O1)C3(C)C)c1cccs1 |
| InChI | InChI=1S/C19H28O2S/c1-5-14(15-7-6-10-22-15)20-16-11-12-13-8-9-19(4,17(12)21-16)18(13,2)3/h6-7,10,12-14,16-17H,5,8-9,11H2,1-4H3/t12-,13+,14-,16-,17-,19-/m0/s1 |
| InChIKey | JDUFNIZKNMEJGE-NXPAPKPCSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |