C20H30O2S — CID 15091804
(1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylbutoxy]-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 15091804) has the molecular formula C20H30O2S and a molecular weight of 334.53 g/mol. Its IUPAC name is (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylbutoxy]-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylbutoxy]-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 15091804 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1S)-1-thiophen-2-ylbutoxy]-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | CCC[C@H](O[C@@H]1C[C@H]2[C@H]3CC[C@@](C)([C@H]2O1)C3(C)C)c1cccs1 |
| InChI | InChI=1S/C20H30O2S/c1-5-7-15(16-8-6-11-23-16)21-17-12-13-14-9-10-20(4,18(13)22-17)19(14,2)3/h6,8,11,13-15,17-18H,5,7,9-10,12H2,1-4H3/t13-,14+,15-,17-,18-,20-/m0/s1 |
| InChIKey | FFQRPIMAUKHGGC-IOLYPPGKSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |