C19H28O2S — CID 15091810
(1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1R)-1-(5-methylthiophen-2-yl)ethoxy]-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 15091810) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1R)-1-(5-methylthiophen-2-yl)ethoxy]-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1R)-1-(5-methylthiophen-2-yl)ethoxy]-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 15091810 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1R,2S,4R,6S,7R)-1,10,10-trimethyl-4-[(1R)-1-(5-methylthiophen-2-yl)ethoxy]-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | Cc1ccc([C@@H](C)O[C@@H]2C[C@H]3[C@H]4CC[C@@](C)([C@H]3O2)C4(C)C)s1 |
| InChI | InChI=1S/C19H28O2S/c1-11-6-7-15(22-11)12(2)20-16-10-13-14-8-9-19(5,17(13)21-16)18(14,3)4/h6-7,12-14,16-17H,8-10H2,1-5H3/t12-,13+,14-,16+,17+,19+/m1/s1 |
| InChIKey | GGIDABSCISPPSH-YDMXMDNUSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |