C21H31F5O4 — CID 150921908
1,1-diethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol (PubChem CID 150921908) has the molecular formula C21H31F5O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1,1-diethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol.
| Compound Name | 1,1-diethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol |
|---|---|
| PubChem CID | 150921908 |
| Molecular Formula | C21H31F5O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1,1-diethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol |
| SMILES | CCCCCCCCC(COc1c(F)c(F)c(F)c(F)c1F)C(O)(OCC)OCC |
| InChI | InChI=1S/C21H31F5O4/c1-4-7-8-9-10-11-12-14(21(27,29-5-2)30-6-3)13-28-20-18(25)16(23)15(22)17(24)19(20)26/h14,27H,4-13H2,1-3H3 |
| InChIKey | LEEWQARVOGVKSV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|