C21H16O5S — CID 15092369
methyl 1,1-dioxo-3,3-diphenyl-2,1lambda6-benzoxathiole-7-carboxylate (PubChem CID 15092369) has the molecular formula C21H16O5S and a molecular weight of 380.42 g/mol. Its IUPAC name is methyl 1,1-dioxo-3,3-diphenyl-2,1lambda6-benzoxathiole-7-carboxylate.
| Compound Name | methyl 1,1-dioxo-3,3-diphenyl-2,1lambda6-benzoxathiole-7-carboxylate |
|---|---|
| PubChem CID | 15092369 |
| Molecular Formula | C21H16O5S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | methyl 1,1-dioxo-3,3-diphenyl-2,1lambda6-benzoxathiole-7-carboxylate |
| SMILES | COC(=O)c1cccc2c1S(=O)(=O)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16O5S/c1-25-20(22)17-13-8-14-18-19(17)27(23,24)26-21(18,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-14H,1H3 |
| InChIKey | PXMIUVRFNXOSBG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|