About 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid
2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150924054) has the molecular formula C10H14O5S
and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 150924054 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1C=CC(S(C)(=O)=O)=C(O)C1(C)C(=O)O |
| InChI | InChI=1S/C10H14O5S/c1-6-4-5-7(16(3,14)15)8(11)10(6,2)9(12)13/h4-6,11H,1-3H3,(H,12,13) |
| InChIKey | LEQFMZSLRRDBKG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid (CID 150924054) is 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid is CC1C=CC(S(C)(=O)=O)=C(O)C1(C)C(=O)O.
What is the InChIKey of 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is LEQFMZSLRRDBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5S/c1-6-4-5-7(16(3,14)15)8(11)10(6,2)9(12)13/h4-6,11H,1-3H3,(H,12,13).
What are the key properties of 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid?
2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 246.28 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,6-dimethyl-3-methylsulfonylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 150924054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).