About amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate
amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate (PubChem CID 150928421) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate.
Molecular Properties
| Compound Name | amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate |
| PubChem CID | 150928421 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate |
| SMILES | C=C1C=CC(NC(=O)ON)=CC1 |
| InChI | InChI=1S/C8H10N2O2/c1-6-2-4-7(5-3-6)10-8(11)12-9/h2,4-5H,1,3,9H2,(H,10,11) |
| InChIKey | LFMVHQQQJKSSAN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate?
The IUPAC name of amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate (CID 150928421) is amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate.
What is the SMILES notation for amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate?
The canonical SMILES for amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate is C=C1C=CC(NC(=O)ON)=CC1.
What is the InChIKey of amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate?
The InChIKey is LFMVHQQQJKSSAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6-2-4-7(5-3-6)10-8(11)12-9/h2,4-5H,1,3,9H2,(H,10,11).
What are the key properties of amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate?
amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate has a molecular weight of 166.18 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-(4-methylidenecyclohexa-1,5-dien-1-yl)carbamate is sourced from PubChem (CID 150928421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).