About 3-sulfanyl-2H-1,3-thiazole-4-thiol
3-sulfanyl-2H-1,3-thiazole-4-thiol (PubChem CID 150929551) has the molecular formula C3H5NS3
and a molecular weight of 151.28 g/mol. Its IUPAC name is 3-sulfanyl-2H-1,3-thiazole-4-thiol.
Molecular Properties
| Compound Name | 3-sulfanyl-2H-1,3-thiazole-4-thiol |
| PubChem CID | 150929551 |
| Molecular Formula | C3H5NS3 |
| Molecular Weight | 151.28 g/mol |
| Exact Mass | 150.96 |
| IUPAC Name | 3-sulfanyl-2H-1,3-thiazole-4-thiol |
| SMILES | SC1=CSCN1S |
| InChI | InChI=1S/C3H5NS3/c5-3-1-7-2-4(3)6/h1,5-6H,2H2 |
| InChIKey | LFSSTXZZGXSORR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanyl-2H-1,3-thiazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanyl-2H-1,3-thiazole-4-thiol?
The IUPAC name of 3-sulfanyl-2H-1,3-thiazole-4-thiol (CID 150929551) is 3-sulfanyl-2H-1,3-thiazole-4-thiol.
What is the SMILES notation for 3-sulfanyl-2H-1,3-thiazole-4-thiol?
The canonical SMILES for 3-sulfanyl-2H-1,3-thiazole-4-thiol is SC1=CSCN1S.
What is the InChIKey of 3-sulfanyl-2H-1,3-thiazole-4-thiol?
The InChIKey is LFSSTXZZGXSORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NS3/c5-3-1-7-2-4(3)6/h1,5-6H,2H2.
What are the key properties of 3-sulfanyl-2H-1,3-thiazole-4-thiol?
3-sulfanyl-2H-1,3-thiazole-4-thiol has a molecular weight of 151.28 g/mol, XLogP of 1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanyl-2H-1,3-thiazole-4-thiol is sourced from PubChem (CID 150929551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).