About diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate
diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate (PubChem CID 15093060) has the molecular formula C17H28O6Si
and a molecular weight of 356.49 g/mol. Its IUPAC name is diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
| PubChem CID | 15093060 |
| Molecular Formula | C17H28O6Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(C(=O)OCC)C(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C17H28O6Si/c1-7-21-15(18)13-10-9-11-17(20-3,23-24(4,5)6)14(12-13)16(19)22-8-2/h9,11-12,14H,7-8,10H2,1-6H3 |
| InChIKey | DJXAQLLOTOIFIZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate?
The IUPAC name of diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate (CID 15093060) is diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate.
What is the SMILES notation for diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate?
The canonical SMILES for diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate is CCOC(=O)C1=CC(C(=O)OCC)C(OC)(O[Si](C)(C)C)C=CC1.
What is the InChIKey of diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate?
The InChIKey is DJXAQLLOTOIFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O6Si/c1-7-21-15(18)13-10-9-11-17(20-3,23-24(4,5)6)14(12-13)16(19)22-8-2/h9,11-12,14H,7-8,10H2,1-6H3.
What are the key properties of diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate?
diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate has a molecular weight of 356.49 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 15093060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).