About methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate
methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15093061) has the molecular formula C19H26O4Si
and a molecular weight of 346.50 g/mol. Its IUPAC name is methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| PubChem CID | 15093061 |
| Molecular Formula | C19H26O4Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(c2ccccc2)C(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C19H26O4Si/c1-21-18(20)16-12-9-13-19(22-2,23-24(3,4)5)17(14-16)15-10-7-6-8-11-15/h6-11,13-14,17H,12H2,1-5H3 |
| InChIKey | ROPLJLJWSLHKLM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (CID 15093061) is methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate is COC(=O)C1=CC(c2ccccc2)C(OC)(O[Si](C)(C)C)C=CC1.
What is the InChIKey of methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The InChIKey is ROPLJLJWSLHKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4Si/c1-21-18(20)16-12-9-13-19(22-2,23-24(3,4)5)17(14-16)15-10-7-6-8-11-15/h6-11,13-14,17H,12H2,1-5H3.
What are the key properties of methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate has a molecular weight of 346.50 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate is sourced from PubChem (CID 15093061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).