About ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate
ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15093063) has the molecular formula C20H28O6SSi
and a molecular weight of 424.59 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| PubChem CID | 15093063 |
| Molecular Formula | C20H28O6SSi |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(S(=O)(=O)c2ccccc2)C(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C20H28O6SSi/c1-6-25-19(21)16-11-10-14-20(24-2,26-28(3,4)5)18(15-16)27(22,23)17-12-8-7-9-13-17/h7-10,12-15,18H,6,11H2,1-5H3 |
| InChIKey | NMTHGTHOKNPONF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The IUPAC name of ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (CID 15093063) is ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
What is the SMILES notation for ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The canonical SMILES for ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate is CCOC(=O)C1=CC(S(=O)(=O)c2ccccc2)C(OC)(O[Si](C)(C)C)C=CC1.
What is the InChIKey of ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
The InChIKey is NMTHGTHOKNPONF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O6SSi/c1-6-25-19(21)16-11-10-14-20(24-2,26-28(3,4)5)18(15-16)27(22,23)17-12-8-7-9-13-17/h7-10,12-15,18H,6,11H2,1-5H3.
What are the key properties of ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate?
ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate has a molecular weight of 424.59 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(benzenesulfonyl)-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate is sourced from PubChem (CID 15093063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).