About 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone
1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone (PubChem CID 15093066) has the molecular formula C19H26O3Si
and a molecular weight of 330.50 g/mol. Its IUPAC name is 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone |
| PubChem CID | 15093066 |
| Molecular Formula | C19H26O3Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone |
| SMILES | COC1(O[Si](C)(C)C)C=CCC(C(C)=O)=CC1c1ccccc1 |
| InChI | InChI=1S/C19H26O3Si/c1-15(20)17-12-9-13-19(21-2,22-23(3,4)5)18(14-17)16-10-7-6-8-11-16/h6-11,13-14,18H,12H2,1-5H3 |
| InChIKey | INSQXMLXBZZCQD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone?
The IUPAC name of 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone (CID 15093066) is 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone.
What is the SMILES notation for 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone?
The canonical SMILES for 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone is COC1(O[Si](C)(C)C)C=CCC(C(C)=O)=CC1c1ccccc1.
What is the InChIKey of 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone?
The InChIKey is INSQXMLXBZZCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O3Si/c1-15(20)17-12-9-13-19(21-2,22-23(3,4)5)18(14-17)16-10-7-6-8-11-16/h6-11,13-14,18H,12H2,1-5H3.
What are the key properties of 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone?
1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone has a molecular weight of 330.50 g/mol, XLogP of 4.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-dien-1-yl)ethanone is sourced from PubChem (CID 15093066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).