About (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid
(11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid (PubChem CID 15093132) has the molecular formula C25H19NO4S
and a molecular weight of 429.50 g/mol. Its IUPAC name is (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid.
Molecular Properties
| Compound Name | (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid |
| PubChem CID | 15093132 |
| Molecular Formula | C25H19NO4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)/C(=C/CN1C(=O)CSc3ccccc31)c1ccccc1CO2 |
| InChI | InChI=1S/C25H19NO4S/c27-24-15-31-23-8-4-3-7-21(23)26(24)12-11-19-18-6-2-1-5-17(18)14-30-22-10-9-16(25(28)29)13-20(19)22/h1-11,13H,12,14-15H2,(H,28,29)/b19-11+ |
| InChIKey | VLYAYCVZHWLBNC-YBFXNURJSA-N |
| XLogP | 4.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid?
The IUPAC name of (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid (CID 15093132) is (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid.
What is the SMILES notation for (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid?
The canonical SMILES for (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid is O=C(O)c1ccc2c(c1)/C(=C/CN1C(=O)CSc3ccccc31)c1ccccc1CO2.
What is the InChIKey of (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid?
The InChIKey is VLYAYCVZHWLBNC-YBFXNURJSA-N. The full InChI is InChI=1S/C25H19NO4S/c27-24-15-31-23-8-4-3-7-21(23)26(24)12-11-19-18-6-2-1-5-17(18)14-30-22-10-9-16(25(28)29)13-20(19)22/h1-11,13H,12,14-15H2,(H,28,29)/b19-11+.
What are the key properties of (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid?
(11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid has a molecular weight of 429.50 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (11E)-11-[2-(3-oxo-1,4-benzothiazin-4-yl)ethylidene]-6H-benzo[c][1]benzoxepine-2-carboxylic acid is sourced from PubChem (CID 15093132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).