C28H57O6PS — CID 150931568
[3-decylsulfanyldodecan-2-yloxy(propoxy)phosphoryl] ethyl carbonate (PubChem CID 150931568) has the molecular formula C28H57O6PS and a molecular weight of 552.80 g/mol. Its IUPAC name is [3-decylsulfanyldodecan-2-yloxy(propoxy)phosphoryl] ethyl carbonate.
| Compound Name | [3-decylsulfanyldodecan-2-yloxy(propoxy)phosphoryl] ethyl carbonate |
|---|---|
| PubChem CID | 150931568 |
| Molecular Formula | C28H57O6PS |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | [3-decylsulfanyldodecan-2-yloxy(propoxy)phosphoryl] ethyl carbonate |
| SMILES | CCCCCCCCCCSC(CCCCCCCCC)C(C)OP(=O)(OCCC)OC(=O)OCC |
| InChI | InChI=1S/C28H57O6PS/c1-6-10-12-14-16-18-20-22-25-36-27(23-21-19-17-15-13-11-7-2)26(5)33-35(30,32-24-8-3)34-28(29)31-9-4/h26-27H,6-25H2,1-5H3 |
| InChIKey | LGDICYLYSJAEGM-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|