About 4-bromo-3,5-difluoroindol-2-one
4-bromo-3,5-difluoroindol-2-one (PubChem CID 150934837) has the molecular formula C8H2BrF2NO
and a molecular weight of 246.01 g/mol. Its IUPAC name is 4-bromo-3,5-difluoroindol-2-one.
Molecular Properties
| Compound Name | 4-bromo-3,5-difluoroindol-2-one |
| PubChem CID | 150934837 |
| Molecular Formula | C8H2BrF2NO |
| Molecular Weight | 246.01 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | 4-bromo-3,5-difluoroindol-2-one |
| SMILES | O=C1N=c2ccc(F)c(Br)c2=C1F |
| InChI | InChI=1S/C8H2BrF2NO/c9-6-3(10)1-2-4-5(6)7(11)8(13)12-4/h1-2H |
| InChIKey | LGUMDFKIWDAHDG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.01 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-3,5-difluoroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-difluoroindol-2-one?
The IUPAC name of 4-bromo-3,5-difluoroindol-2-one (CID 150934837) is 4-bromo-3,5-difluoroindol-2-one.
What is the SMILES notation for 4-bromo-3,5-difluoroindol-2-one?
The canonical SMILES for 4-bromo-3,5-difluoroindol-2-one is O=C1N=c2ccc(F)c(Br)c2=C1F.
What is the InChIKey of 4-bromo-3,5-difluoroindol-2-one?
The InChIKey is LGUMDFKIWDAHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2BrF2NO/c9-6-3(10)1-2-4-5(6)7(11)8(13)12-4/h1-2H.
What are the key properties of 4-bromo-3,5-difluoroindol-2-one?
4-bromo-3,5-difluoroindol-2-one has a molecular weight of 246.01 g/mol, XLogP of 0.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-difluoroindol-2-one is sourced from PubChem (CID 150934837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).