About (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate
(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate (PubChem CID 150935424) has the molecular formula C6H9O6P
and a molecular weight of 208.11 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate.
Molecular Properties
| Compound Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate |
| PubChem CID | 150935424 |
| Molecular Formula | C6H9O6P |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate |
| SMILES | CC=CC(=O)OCC1OP(=O)(O)O1 |
| InChI | InChI=1S/C6H9O6P/c1-2-3-5(7)10-4-6-11-13(8,9)12-6/h2-3,6H,4H2,1H3,(H,8,9) |
| InChIKey | LGXOFRAUZAWJDA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate?
The IUPAC name of (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate (CID 150935424) is (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate.
What is the SMILES notation for (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate?
The canonical SMILES for (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate is CC=CC(=O)OCC1OP(=O)(O)O1.
What is the InChIKey of (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate?
The InChIKey is LGXOFRAUZAWJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O6P/c1-2-3-5(7)10-4-6-11-13(8,9)12-6/h2-3,6H,4H2,1H3,(H,8,9).
What are the key properties of (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate?
(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate has a molecular weight of 208.11 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)methyl but-2-enoate is sourced from PubChem (CID 150935424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).