C15H21F3O3 — CID 15093676
ethyl (1S,2R)-1-hydroxy-2-methyl-1-(trifluoromethyl)-3,4,5,6,7,8-hexahydronaphthalene-2-carboxylate (PubChem CID 15093676) has the molecular formula C15H21F3O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl (1S,2R)-1-hydroxy-2-methyl-1-(trifluoromethyl)-3,4,5,6,7,8-hexahydronaphthalene-2-carboxylate.
| Compound Name | ethyl (1S,2R)-1-hydroxy-2-methyl-1-(trifluoromethyl)-3,4,5,6,7,8-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 15093676 |
| Molecular Formula | C15H21F3O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl (1S,2R)-1-hydroxy-2-methyl-1-(trifluoromethyl)-3,4,5,6,7,8-hexahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC2=C(CCCC2)[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3/c1-3-21-12(19)13(2)9-8-10-6-4-5-7-11(10)14(13,20)15(16,17)18/h20H,3-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | AGMCWNBJPXTDTN-KBPBESRZSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|