C14H19F3O3 — CID 15093680
ethyl (2S,3R)-3-hydroxy-2-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indene-2-carboxylate (PubChem CID 15093680) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is ethyl (2S,3R)-3-hydroxy-2-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indene-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-hydroxy-2-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 15093680 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | ethyl (2S,3R)-3-hydroxy-2-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)CC2=C(CCCC2)[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O3/c1-3-20-11(18)12(2)8-9-6-4-5-7-10(9)13(12,19)14(15,16)17/h19H,3-8H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | BQACHPRTCIDQNA-CHWSQXEVSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|