About N-decyl-2-methyl-1,3-thiazol-4-amine
N-decyl-2-methyl-1,3-thiazol-4-amine (PubChem CID 150937777) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is N-decyl-2-methyl-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | N-decyl-2-methyl-1,3-thiazol-4-amine |
| PubChem CID | 150937777 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-decyl-2-methyl-1,3-thiazol-4-amine |
| SMILES | CCCCCCCCCCNc1csc(C)n1 |
| InChI | InChI=1S/C14H26N2S/c1-3-4-5-6-7-8-9-10-11-15-14-12-17-13(2)16-14/h12,15H,3-11H2,1-2H3 |
| InChIKey | LHJZDCQDQSMKDY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decyl-2-methyl-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyl-2-methyl-1,3-thiazol-4-amine?
The IUPAC name of N-decyl-2-methyl-1,3-thiazol-4-amine (CID 150937777) is N-decyl-2-methyl-1,3-thiazol-4-amine.
What is the SMILES notation for N-decyl-2-methyl-1,3-thiazol-4-amine?
The canonical SMILES for N-decyl-2-methyl-1,3-thiazol-4-amine is CCCCCCCCCCNc1csc(C)n1.
What is the InChIKey of N-decyl-2-methyl-1,3-thiazol-4-amine?
The InChIKey is LHJZDCQDQSMKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-3-4-5-6-7-8-9-10-11-15-14-12-17-13(2)16-14/h12,15H,3-11H2,1-2H3.
What are the key properties of N-decyl-2-methyl-1,3-thiazol-4-amine?
N-decyl-2-methyl-1,3-thiazol-4-amine has a molecular weight of 254.44 g/mol, XLogP of 5.00, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyl-2-methyl-1,3-thiazol-4-amine is sourced from PubChem (CID 150937777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).