About 4,4-dichlorocyclohexa-1,5-diene-1-thiol
4,4-dichlorocyclohexa-1,5-diene-1-thiol (PubChem CID 150944690) has the molecular formula C6H6Cl2S
and a molecular weight of 181.09 g/mol. Its IUPAC name is 4,4-dichlorocyclohexa-1,5-diene-1-thiol.
Molecular Properties
| Compound Name | 4,4-dichlorocyclohexa-1,5-diene-1-thiol |
| PubChem CID | 150944690 |
| Molecular Formula | C6H6Cl2S |
| Molecular Weight | 181.09 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | 4,4-dichlorocyclohexa-1,5-diene-1-thiol |
| SMILES | SC1=CCC(Cl)(Cl)C=C1 |
| InChI | InChI=1S/C6H6Cl2S/c7-6(8)3-1-5(9)2-4-6/h1-3,9H,4H2 |
| InChIKey | LIUILNAPHLFYPI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dichlorocyclohexa-1,5-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dichlorocyclohexa-1,5-diene-1-thiol?
The IUPAC name of 4,4-dichlorocyclohexa-1,5-diene-1-thiol (CID 150944690) is 4,4-dichlorocyclohexa-1,5-diene-1-thiol.
What is the SMILES notation for 4,4-dichlorocyclohexa-1,5-diene-1-thiol?
The canonical SMILES for 4,4-dichlorocyclohexa-1,5-diene-1-thiol is SC1=CCC(Cl)(Cl)C=C1.
What is the InChIKey of 4,4-dichlorocyclohexa-1,5-diene-1-thiol?
The InChIKey is LIUILNAPHLFYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2S/c7-6(8)3-1-5(9)2-4-6/h1-3,9H,4H2.
What are the key properties of 4,4-dichlorocyclohexa-1,5-diene-1-thiol?
4,4-dichlorocyclohexa-1,5-diene-1-thiol has a molecular weight of 181.09 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dichlorocyclohexa-1,5-diene-1-thiol is sourced from PubChem (CID 150944690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).