C31H36BrNO3 — CID 15094498
2-[4-[(E)-2-(4-bromophenyl)-1-[4-(oxan-2-yloxy)phenyl]but-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 15094498) has the molecular formula C31H36BrNO3 and a molecular weight of 550.54 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-bromophenyl)-1-[4-(oxan-2-yloxy)phenyl]but-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(E)-2-(4-bromophenyl)-1-[4-(oxan-2-yloxy)phenyl]but-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 15094498 |
| Molecular Formula | C31H36BrNO3 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 2-[4-[(E)-2-(4-bromophenyl)-1-[4-(oxan-2-yloxy)phenyl]but-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1ccc(OC2CCCCO2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H36BrNO3/c1-4-29(23-8-14-26(32)15-9-23)31(24-10-16-27(17-11-24)34-22-20-33(2)3)25-12-18-28(19-13-25)36-30-7-5-6-21-35-30/h8-19,30H,4-7,20-22H2,1-3H3/b31-29+ |
| InChIKey | KISPSUVPBYYYBR-OWWNRXNESA-N |
| XLogP | 7.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|