About CID 150945455
CID 150945455 (PubChem CID 150945455) has the molecular formula H4N2O17S9
and a molecular weight of 592.63 g/mol.
Molecular Properties
| Compound Name | CID 150945455 |
| PubChem CID | 150945455 |
| Molecular Formula | H4N2O17S9 |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 591.70 |
| IUPAC Name | — |
| SMILES | O=S(O)N(S(=O)N(S(=O)O)S(=O)(=O)SOS(=O)(=O)O)S(=O)(=O)SOS(=O)(=O)O |
| InChI | InChI=1S/H4N2O17S9/c3-22(1(23(4)5)25(8,9)20-18-27(12,13)14)2(24(6)7)26(10,11)21-19-28(15,16)17/h(H,4,5)(H,6,7)(H,12,13,14)(H,15,16,17) |
| InChIKey | LIYMWTUNFUKIQT-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 293.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 150945455 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150945455?
The IUPAC name of CID 150945455 (CID 150945455) is not available.
What is the SMILES notation for CID 150945455?
The canonical SMILES for CID 150945455 is O=S(O)N(S(=O)N(S(=O)O)S(=O)(=O)SOS(=O)(=O)O)S(=O)(=O)SOS(=O)(=O)O.
What is the InChIKey of CID 150945455?
The InChIKey is LIYMWTUNFUKIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O17S9/c3-22(1(23(4)5)25(8,9)20-18-27(12,13)14)2(24(6)7)26(10,11)21-19-28(15,16)17/h(H,4,5)(H,6,7)(H,12,13,14)(H,15,16,17).
What are the key properties of CID 150945455?
CID 150945455 has a molecular weight of 592.63 g/mol, XLogP of -3.13, 12 rotatable bonds, 4 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150945455 is sourced from PubChem (CID 150945455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).