C10H12ClN3O — CID 150947445
2-(5-chloro-2-pyridinyl)-5,5-dimethylpyrazolidin-3-one (PubChem CID 150947445) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-5,5-dimethylpyrazolidin-3-one.
| Compound Name | 2-(5-chloro-2-pyridinyl)-5,5-dimethylpyrazolidin-3-one |
|---|---|
| PubChem CID | 150947445 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-5,5-dimethylpyrazolidin-3-one |
| SMILES | CC1(C)CC(=O)N(c2ccc(Cl)cn2)N1 |
| InChI | InChI=1S/C10H12ClN3O/c1-10(2)5-9(15)14(13-10)8-4-3-7(11)6-12-8/h3-4,6,13H,5H2,1-2H3 |
| InChIKey | LJJBNHCVLHHGGK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |