About azepine-2,7-dione
azepine-2,7-dione (PubChem CID 15094758) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is azepine-2,7-dione.
Molecular Properties
| Compound Name | azepine-2,7-dione |
| PubChem CID | 15094758 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | azepine-2,7-dione |
| SMILES | O=c1ccccc(=O)[nH]1 |
| InChI | InChI=1S/C6H5NO2/c8-5-3-1-2-4-6(9)7-5/h1-4H,(H,7,8,9) |
| InChIKey | FJQZWODWLBQDBR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azepine-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepine-2,7-dione?
The IUPAC name of azepine-2,7-dione (CID 15094758) is azepine-2,7-dione.
What is the SMILES notation for azepine-2,7-dione?
The canonical SMILES for azepine-2,7-dione is O=c1ccccc(=O)[nH]1.
What is the InChIKey of azepine-2,7-dione?
The InChIKey is FJQZWODWLBQDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c8-5-3-1-2-4-6(9)7-5/h1-4H,(H,7,8,9).
What are the key properties of azepine-2,7-dione?
azepine-2,7-dione has a molecular weight of 123.11 g/mol, XLogP of -0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepine-2,7-dione is sourced from PubChem (CID 15094758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).