About 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione
4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione (PubChem CID 150948037) has the molecular formula C10H17N5O2
and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione.
Molecular Properties
| Compound Name | 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione |
| PubChem CID | 150948037 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione |
| SMILES | CN1C(=O)C2N(C)C=NC2(N(C)C)N(C)C1=O |
| InChI | InChI=1S/C10H17N5O2/c1-12(2)10-7(13(3)6-11-10)8(16)14(4)9(17)15(10)5/h6-7H,1-5H3 |
| InChIKey | LJMGIDQZLQXUTO-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione?
The IUPAC name of 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione (CID 150948037) is 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione.
What is the SMILES notation for 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione?
The canonical SMILES for 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione is CN1C(=O)C2N(C)C=NC2(N(C)C)N(C)C1=O.
What is the InChIKey of 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione?
The InChIKey is LJMGIDQZLQXUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O2/c1-12(2)10-7(13(3)6-11-10)8(16)14(4)9(17)15(10)5/h6-7H,1-5H3.
What are the key properties of 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione?
4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione has a molecular weight of 239.28 g/mol, XLogP of -0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-1,3,7-trimethyl-5H-purine-2,6-dione is sourced from PubChem (CID 150948037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).