C20H30O7S — CID 15094925
tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate (PubChem CID 15094925) has the molecular formula C20H30O7S and a molecular weight of 414.52 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 15094925 |
| Molecular Formula | C20H30O7S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H30O7S/c1-14-7-9-17(10-8-14)28(22,23)24-13-16-11-15(25-20(5,6)26-16)12-18(21)27-19(2,3)4/h7-10,15-16H,11-13H2,1-6H3/t15-,16+/m1/s1 |
| InChIKey | ZXTBWCRYQSGGPW-CVEARBPZSA-N |
| XLogP | 3.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|