About [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate
[5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate (PubChem CID 150951794) has the molecular formula C19H17FN2O4
and a molecular weight of 356.35 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate |
| PubChem CID | 150951794 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)OC1N=C(c2ccccc2F)c2cc(C(C)O)ccc2NC1=O |
| InChI | InChI=1S/C19H17FN2O4/c1-10(23)12-7-8-16-14(9-12)17(13-5-3-4-6-15(13)20)22-19(18(25)21-16)26-11(2)24/h3-10,19,23H,1-2H3,(H,21,25) |
| InChIKey | LKGGVWGDQOJIGN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate?
The IUPAC name of [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate (CID 150951794) is [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate.
What is the SMILES notation for [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate?
The canonical SMILES for [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate is CC(=O)OC1N=C(c2ccccc2F)c2cc(C(C)O)ccc2NC1=O.
What is the InChIKey of [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate?
The InChIKey is LKGGVWGDQOJIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O4/c1-10(23)12-7-8-16-14(9-12)17(13-5-3-4-6-15(13)20)22-19(18(25)21-16)26-11(2)24/h3-10,19,23H,1-2H3,(H,21,25).
What are the key properties of [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate?
[5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate has a molecular weight of 356.35 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-fluorophenyl)-7-(1-hydroxyethyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate is sourced from PubChem (CID 150951794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).