C23H33N3O5S2 — CID 150952949
8-(4-acetylbenzoyl)sulfonyl-4-butyl-2-(2-methylsulfanylethyl)-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 150952949) has the molecular formula C23H33N3O5S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 8-(4-acetylbenzoyl)sulfonyl-4-butyl-2-(2-methylsulfanylethyl)-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-(4-acetylbenzoyl)sulfonyl-4-butyl-2-(2-methylsulfanylethyl)-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 150952949 |
| Molecular Formula | C23H33N3O5S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 8-(4-acetylbenzoyl)sulfonyl-4-butyl-2-(2-methylsulfanylethyl)-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CCCCN1C(=O)C(CCSC)NC12CCN(S(=O)(=O)C(=O)c1ccc(C(C)=O)cc1)CC2 |
| InChI | InChI=1S/C23H33N3O5S2/c1-4-5-13-26-21(28)20(10-16-32-3)24-23(26)11-14-25(15-12-23)33(30,31)22(29)19-8-6-18(7-9-19)17(2)27/h6-9,20,24H,4-5,10-16H2,1-3H3 |
| InChIKey | LKMHAFHAUNEBHK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|