About CID 150955062
CID 150955062 (PubChem CID 150955062) has the molecular formula C27H46O4SSi
and a molecular weight of 494.81 g/mol.
Molecular Properties
| Compound Name | CID 150955062 |
| PubChem CID | 150955062 |
| Molecular Formula | C27H46O4SSi |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)SCCC[Si]Oc1cc(OC)c(C(C)(C)C)c(OC)c1C(C)(C)C |
| InChI | InChI=1S/C27H46O4SSi/c1-10-11-12-13-14-16-22(28)32-17-15-18-33-31-21-19-20(29-8)23(26(2,3)4)25(30-9)24(21)27(5,6)7/h19H,10-18H2,1-9H3 |
| InChIKey | RMOWNWDNUJLRND-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 150955062 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150955062?
The IUPAC name of CID 150955062 (CID 150955062) is not available.
What is the SMILES notation for CID 150955062?
The canonical SMILES for CID 150955062 is CCCCCCCC(=O)SCCC[Si]Oc1cc(OC)c(C(C)(C)C)c(OC)c1C(C)(C)C.
What is the InChIKey of CID 150955062?
The InChIKey is RMOWNWDNUJLRND-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H46O4SSi/c1-10-11-12-13-14-16-22(28)32-17-15-18-33-31-21-19-20(29-8)23(26(2,3)4)25(30-9)24(21)27(5,6)7/h19H,10-18H2,1-9H3.
What are the key properties of CID 150955062?
CID 150955062 has a molecular weight of 494.81 g/mol, XLogP of 7.73, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150955062 is sourced from PubChem (CID 150955062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).